C15H19FN4O2 — CID 175479709
3-[[5-fluoro-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridin-3-yl]amino]piperidine-2,6-dione (PubChem CID 175479709) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-[[5-fluoro-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridin-3-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-fluoro-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridin-3-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175479709 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-[[5-fluoro-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2-dihydropyridin-3-yl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NC2=CC(F)=C(C3=CCNCC3)NC2)C(=O)N1 |
| InChI | InChI=1S/C15H19FN4O2/c16-11-7-10(19-12-1-2-13(21)20-15(12)22)8-18-14(11)9-3-5-17-6-4-9/h3,7,12,17-19H,1-2,4-6,8H2,(H,20,21,22) |
| InChIKey | AQOBKTMYBDGUSM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|