About N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane
N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane (PubChem CID 175479879) has the molecular formula C11H27NSn
and a molecular weight of 292.06 g/mol. Its IUPAC name is N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane.
Molecular Properties
| Compound Name | N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane |
| PubChem CID | 175479879 |
| Molecular Formula | C11H27NSn |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane |
| SMILES | CC(C)(C)NC(C)(C)C.CCC[SnH] |
| InChI | InChI=1S/C8H19N.C3H7.Sn.H/c1-7(2,3)9-8(4,5)6;1-3-2;;/h9H,1-6H3;1,3H2,2H3;; |
| InChIKey | RKBRLVPYRWVLRR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane?
The IUPAC name of N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane (CID 175479879) is N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane.
What is the SMILES notation for N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane?
The canonical SMILES for N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane is CC(C)(C)NC(C)(C)C.CCC[SnH].
What is the InChIKey of N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane?
The InChIKey is RKBRLVPYRWVLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H7.Sn.H/c1-7(2,3)9-8(4,5)6;1-3-2;;/h9H,1-6H3;1,3H2,2H3;;.
What are the key properties of N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane?
N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane has a molecular weight of 292.06 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-methylpropan-2-amine;propyl-λ2-stannane is sourced from PubChem (CID 175479879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).