About 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride
2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride (PubChem CID 175479937) has the molecular formula C13H24Cl2
and a molecular weight of 251.24 g/mol. Its IUPAC name is 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride.
Molecular Properties
| Compound Name | 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride |
| PubChem CID | 175479937 |
| Molecular Formula | C13H24Cl2 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride |
| SMILES | CC(C)(C)C1=CCC=C1C(C)(C)C.Cl.Cl |
| InChI | InChI=1S/C13H22.2ClH/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;;/h8-9H,7H2,1-6H3;2*1H |
| InChIKey | YWFPJNXQDNANBD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride?
The IUPAC name of 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride (CID 175479937) is 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride.
What is the SMILES notation for 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride?
The canonical SMILES for 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride is CC(C)(C)C1=CCC=C1C(C)(C)C.Cl.Cl.
What is the InChIKey of 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride?
The InChIKey is YWFPJNXQDNANBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22.2ClH/c1-12(2,3)10-8-7-9-11(10)13(4,5)6;;/h8-9H,7H2,1-6H3;2*1H.
What are the key properties of 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride?
2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride has a molecular weight of 251.24 g/mol, XLogP of 5.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butylcyclopenta-1,3-diene;dihydrochloride is sourced from PubChem (CID 175479937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).