About 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole
2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole (PubChem CID 175480648) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole.
Molecular Properties
| Compound Name | 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole |
| PubChem CID | 175480648 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole |
| SMILES | Cc1ncc(COc2ccc3oc(C)c(C(N)=O)c3c2)s1.c1cc[nH]c1 |
| InChI | InChI=1S/C15H14N2O3S.C4H5N/c1-8-14(15(16)18)12-5-10(3-4-13(12)20-8)19-7-11-6-17-9(2)21-11;1-2-4-5-3-1/h3-6H,7H2,1-2H3,(H2,16,18);1-5H |
| InChIKey | XSXVCCSVHBADQH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole?
The IUPAC name of 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole (CID 175480648) is 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole.
What is the SMILES notation for 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole?
The canonical SMILES for 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole is Cc1ncc(COc2ccc3oc(C)c(C(N)=O)c3c2)s1.c1cc[nH]c1.
What is the InChIKey of 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole?
The InChIKey is XSXVCCSVHBADQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3S.C4H5N/c1-8-14(15(16)18)12-5-10(3-4-13(12)20-8)19-7-11-6-17-9(2)21-11;1-2-4-5-3-1/h3-6H,7H2,1-2H3,(H2,16,18);1-5H.
What are the key properties of 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole?
2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole has a molecular weight of 369.45 g/mol, XLogP of 4.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-1-benzofuran-3-carboxamide;1H-pyrrole is sourced from PubChem (CID 175480648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).