C20H36N2O6 — CID 175481335
[3-methoxypropyl-[(2S)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoyl]amino] cyclopropanecarboxylate (PubChem CID 175481335) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is [3-methoxypropyl-[(2S)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoyl]amino] cyclopropanecarboxylate.
| Compound Name | [3-methoxypropyl-[(2S)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoyl]amino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175481335 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [3-methoxypropyl-[(2S)-4-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoyl]amino] cyclopropanecarboxylate |
| SMILES | COCCCN(OC(=O)C1CC1)C(=O)[C@H](CC(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N2O6/c1-14(2)13-16(21(6)19(25)27-20(3,4)5)17(23)22(11-8-12-26-7)28-18(24)15-9-10-15/h14-16H,8-13H2,1-7H3/t16-/m0/s1 |
| InChIKey | DZQIWFNGTKMPAQ-INIZCTEOSA-N |
| XLogP | 3.00 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|