C20H22Cl2N2O3 — CID 175481649
methyl 3-(2-amino-3-phenylpropoxy)isoquinoline-4-carboxylate;dihydrochloride (PubChem CID 175481649) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is methyl 3-(2-amino-3-phenylpropoxy)isoquinoline-4-carboxylate;dihydrochloride.
| Compound Name | methyl 3-(2-amino-3-phenylpropoxy)isoquinoline-4-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 175481649 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | methyl 3-(2-amino-3-phenylpropoxy)isoquinoline-4-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1c(OCC(N)Cc2ccccc2)ncc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C20H20N2O3.2ClH/c1-24-20(23)18-17-10-6-5-9-15(17)12-22-19(18)25-13-16(21)11-14-7-3-2-4-8-14;;/h2-10,12,16H,11,13,21H2,1H3;2*1H |
| InChIKey | GQTGOFOTKNKAGV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |