About 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine
5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine (PubChem CID 175482269) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine |
| PubChem CID | 175482269 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine |
| SMILES | CC1C(N)CC(N)CC1(C)C1CCCCC1 |
| InChI | InChI=1S/C14H28N2/c1-10-13(16)8-12(15)9-14(10,2)11-6-4-3-5-7-11/h10-13H,3-9,15-16H2,1-2H3 |
| InChIKey | XLXRKEMOMWHBSU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine?
The IUPAC name of 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine (CID 175482269) is 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine.
What is the SMILES notation for 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine?
The canonical SMILES for 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine is CC1C(N)CC(N)CC1(C)C1CCCCC1.
What is the InChIKey of 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine?
The InChIKey is XLXRKEMOMWHBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-10-13(16)8-12(15)9-14(10,2)11-6-4-3-5-7-11/h10-13H,3-9,15-16H2,1-2H3.
What are the key properties of 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine?
5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine has a molecular weight of 224.39 g/mol, XLogP of 2.66, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-4,5-dimethylcyclohexane-1,3-diamine is sourced from PubChem (CID 175482269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).