C17H25N2O5P — CID 175482320
2-diethoxyphosphoryl-7-(2-methylprop-1-enyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylic acid (PubChem CID 175482320) has the molecular formula C17H25N2O5P and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-7-(2-methylprop-1-enyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylic acid.
| Compound Name | 2-diethoxyphosphoryl-7-(2-methylprop-1-enyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 175482320 |
| Molecular Formula | C17H25N2O5P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-diethoxyphosphoryl-7-(2-methylprop-1-enyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylic acid |
| SMILES | CCOP(=O)(OCC)c1ccc2c(n1)CC(C=C(C)C)N(C(=O)O)C2 |
| InChI | InChI=1S/C17H25N2O5P/c1-5-23-25(22,24-6-2)16-8-7-13-11-19(17(20)21)14(9-12(3)4)10-15(13)18-16/h7-9,14H,5-6,10-11H2,1-4H3,(H,20,21) |
| InChIKey | YVYYOSJNKSNFPO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|