About lithium;butoxymethylbenzene;hydride
lithium;butoxymethylbenzene;hydride (PubChem CID 175482454) has the molecular formula C11H17LiO
and a molecular weight of 172.20 g/mol. Its IUPAC name is lithium;butoxymethylbenzene;hydride.
Molecular Properties
| Compound Name | lithium;butoxymethylbenzene;hydride |
| PubChem CID | 175482454 |
| Molecular Formula | C11H17LiO |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | lithium;butoxymethylbenzene;hydride |
| SMILES | CCCCOCc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C11H16O.Li.H/c1-2-3-9-12-10-11-7-5-4-6-8-11;;/h4-8H,2-3,9-10H2,1H3;;/q;+1;-1 |
| InChIKey | NCVNXAPGEYHLRN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;butoxymethylbenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;butoxymethylbenzene;hydride?
The IUPAC name of lithium;butoxymethylbenzene;hydride (CID 175482454) is lithium;butoxymethylbenzene;hydride.
What is the SMILES notation for lithium;butoxymethylbenzene;hydride?
The canonical SMILES for lithium;butoxymethylbenzene;hydride is CCCCOCc1ccccc1.[H-].[Li+].
What is the InChIKey of lithium;butoxymethylbenzene;hydride?
The InChIKey is NCVNXAPGEYHLRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.Li.H/c1-2-3-9-12-10-11-7-5-4-6-8-11;;/h4-8H,2-3,9-10H2,1H3;;/q;+1;-1.
What are the key properties of lithium;butoxymethylbenzene;hydride?
lithium;butoxymethylbenzene;hydride has a molecular weight of 172.20 g/mol, XLogP of 0.12, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;butoxymethylbenzene;hydride is sourced from PubChem (CID 175482454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).