About indol-2-one;phenol
indol-2-one;phenol (PubChem CID 175483332) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is indol-2-one;phenol.
Molecular Properties
| Compound Name | indol-2-one;phenol |
| PubChem CID | 175483332 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | indol-2-one;phenol |
| SMILES | O=C1C=c2ccccc2=N1.Oc1ccccc1 |
| InChI | InChI=1S/C8H5NO.C6H6O/c10-8-5-6-3-1-2-4-7(6)9-8;7-6-4-2-1-3-5-6/h1-5H;1-5,7H |
| InChIKey | XCOPLOCUURRKTR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indol-2-one;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-one;phenol?
The IUPAC name of indol-2-one;phenol (CID 175483332) is indol-2-one;phenol.
What is the SMILES notation for indol-2-one;phenol?
The canonical SMILES for indol-2-one;phenol is O=C1C=c2ccccc2=N1.Oc1ccccc1.
What is the InChIKey of indol-2-one;phenol?
The InChIKey is XCOPLOCUURRKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C6H6O/c10-8-5-6-3-1-2-4-7(6)9-8;7-6-4-2-1-3-5-6/h1-5H;1-5,7H.
What are the key properties of indol-2-one;phenol?
indol-2-one;phenol has a molecular weight of 225.25 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-one;phenol is sourced from PubChem (CID 175483332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).