C21H40NO4P — CID 175483841
3-hydroxy-2-[[(Z)-octadec-9-enoyl]-phosphanylamino]propanoic acid (PubChem CID 175483841) has the molecular formula C21H40NO4P and a molecular weight of 401.53 g/mol. Its IUPAC name is 3-hydroxy-2-[[(Z)-octadec-9-enoyl]-phosphanylamino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[(Z)-octadec-9-enoyl]-phosphanylamino]propanoic acid |
|---|---|
| PubChem CID | 175483841 |
| Molecular Formula | C21H40NO4P |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 3-hydroxy-2-[[(Z)-octadec-9-enoyl]-phosphanylamino]propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(P)C(CO)C(=O)O |
| InChI | InChI=1S/C21H40NO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22(27)19(18-23)21(25)26/h9-10,19,23H,2-8,11-18,27H2,1H3,(H,25,26)/b10-9- |
| InChIKey | DVIIUORHRBMDGP-KTKRTIGZSA-N |
| XLogP | 5.09 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|