About 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride
2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride (PubChem CID 175484683) has the molecular formula C8H18Cl2N2S
and a molecular weight of 245.22 g/mol. Its IUPAC name is 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride |
| PubChem CID | 175484683 |
| Molecular Formula | C8H18Cl2N2S |
| Molecular Weight | 245.22 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride |
| SMILES | CC(C)C1=NCCN1CCS.Cl.Cl |
| InChI | InChI=1S/C8H16N2S.2ClH/c1-7(2)8-9-3-4-10(8)5-6-11;;/h7,11H,3-6H2,1-2H3;2*1H |
| InChIKey | VKOSNKCXYKTFQQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride?
The IUPAC name of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride (CID 175484683) is 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride.
What is the SMILES notation for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride?
The canonical SMILES for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride is CC(C)C1=NCCN1CCS.Cl.Cl.
What is the InChIKey of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride?
The InChIKey is VKOSNKCXYKTFQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S.2ClH/c1-7(2)8-9-3-4-10(8)5-6-11;;/h7,11H,3-6H2,1-2H3;2*1H.
What are the key properties of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride?
2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride has a molecular weight of 245.22 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol;dihydrochloride is sourced from PubChem (CID 175484683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).