About 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol
2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol (PubChem CID 175484684) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol |
| PubChem CID | 175484684 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol |
| SMILES | CC(C)C1=NCCN1CCS |
| InChI | InChI=1S/C8H16N2S/c1-7(2)8-9-3-4-10(8)5-6-11/h7,11H,3-6H2,1-2H3 |
| InChIKey | HOHPYICUSARSLT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol?
The IUPAC name of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol (CID 175484684) is 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol.
What is the SMILES notation for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol?
The canonical SMILES for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol is CC(C)C1=NCCN1CCS.
What is the InChIKey of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol?
The InChIKey is HOHPYICUSARSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-7(2)8-9-3-4-10(8)5-6-11/h7,11H,3-6H2,1-2H3.
What are the key properties of 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol?
2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol has a molecular weight of 172.30 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propan-2-yl-4,5-dihydroimidazol-1-yl)ethanethiol is sourced from PubChem (CID 175484684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).