About tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium
tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium (PubChem CID 175485360) has the molecular formula C10H18F3NOS
and a molecular weight of 257.32 g/mol. Its IUPAC name is tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium.
Molecular Properties
| Compound Name | tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium |
| PubChem CID | 175485360 |
| Molecular Formula | C10H18F3NOS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(C=CF)C(F)CCF |
| InChI | InChI=1S/C10H18F3NOS/c1-10(2,3)16(15)14-9(5-7-12)8(13)4-6-11/h5,7-9,14H,4,6H2,1-3H3 |
| InChIKey | ZGJZUYZGSCPVGY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium?
The IUPAC name of tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium (CID 175485360) is tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium.
What is the SMILES notation for tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium?
The canonical SMILES for tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium is CC(C)(C)[S+]([O-])NC(C=CF)C(F)CCF.
What is the InChIKey of tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium?
The InChIKey is ZGJZUYZGSCPVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NOS/c1-10(2,3)16(15)14-9(5-7-12)8(13)4-6-11/h5,7-9,14H,4,6H2,1-3H3.
What are the key properties of tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium?
tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium has a molecular weight of 257.32 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-oxido-(1,4,6-trifluorohex-1-en-3-ylamino)sulfanium is sourced from PubChem (CID 175485360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).