About tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium
tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium (PubChem CID 175485396) has the molecular formula C12H22F3NOS
and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium.
Molecular Properties
| Compound Name | tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium |
| PubChem CID | 175485396 |
| Molecular Formula | C12H22F3NOS |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium |
| SMILES | CC(C=CF)C(N[S+]([O-])C(C)(C)C)C(F)CCF |
| InChI | InChI=1S/C12H22F3NOS/c1-9(5-7-13)11(10(15)6-8-14)16-18(17)12(2,3)4/h5,7,9-11,16H,6,8H2,1-4H3 |
| InChIKey | AKHDVEOSDCDHBZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium?
The IUPAC name of tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium (CID 175485396) is tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium.
What is the SMILES notation for tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium?
The canonical SMILES for tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium is CC(C=CF)C(N[S+]([O-])C(C)(C)C)C(F)CCF.
What is the InChIKey of tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium?
The InChIKey is AKHDVEOSDCDHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NOS/c1-9(5-7-13)11(10(15)6-8-14)16-18(17)12(2,3)4/h5,7,9-11,16H,6,8H2,1-4H3.
What are the key properties of tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium?
tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium has a molecular weight of 285.38 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-oxido-[(1,5,7-trifluoro-3-methylhept-1-en-4-yl)amino]sulfanium is sourced from PubChem (CID 175485396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).