About 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid
8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid (PubChem CID 175486179) has the molecular formula C18H29F2NO4
and a molecular weight of 361.43 g/mol. Its IUPAC name is 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid.
Molecular Properties
| Compound Name | 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid |
| PubChem CID | 175486179 |
| Molecular Formula | C18H29F2NO4 |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid |
| SMILES | C=C(C)C(CCC(C)CCCC(=O)O)C(F)(F)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H29F2NO4/c1-13(2)15(8-7-14(3)5-4-6-16(22)23)18(19,20)17(24)21-9-11-25-12-10-21/h14-15H,1,4-12H2,2-3H3,(H,22,23) |
| InChIKey | YGWGQTJTJYTNCK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid?
The IUPAC name of 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid (CID 175486179) is 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid.
What is the SMILES notation for 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid?
The canonical SMILES for 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid is C=C(C)C(CCC(C)CCCC(=O)O)C(F)(F)C(=O)N1CCOCC1.
What is the InChIKey of 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid?
The InChIKey is YGWGQTJTJYTNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29F2NO4/c1-13(2)15(8-7-14(3)5-4-6-16(22)23)18(19,20)17(24)21-9-11-25-12-10-21/h14-15H,1,4-12H2,2-3H3,(H,22,23).
What are the key properties of 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid?
8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid has a molecular weight of 361.43 g/mol, XLogP of 3.34, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-5,9-dimethyldec-9-enoic acid is sourced from PubChem (CID 175486179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).