C9H13F3O2 — CID 175486496
2-(1,2,2-trifluoroethyl)cyclohexane-1-carboxylic acid (PubChem CID 175486496) has the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(1,2,2-trifluoroethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 175486496 |
| Molecular Formula | C9H13F3O2 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1C(F)C(F)F |
| InChI | InChI=1S/C9H13F3O2/c10-7(8(11)12)5-3-1-2-4-6(5)9(13)14/h5-8H,1-4H2,(H,13,14) |
| InChIKey | YHCNSSGPIREWAA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |