About 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine
4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine (PubChem CID 175487726) has the molecular formula C19H20N4O2
and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine |
| PubChem CID | 175487726 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine |
| SMILES | c1cnn(-c2ccc(-c3nccc(CCC4OCCCO4)n3)cc2)c1 |
| InChI | InChI=1S/C19H20N4O2/c1-10-21-23(12-1)17-6-3-15(4-7-17)19-20-11-9-16(22-19)5-8-18-24-13-2-14-25-18/h1,3-4,6-7,9-12,18H,2,5,8,13-14H2 |
| InChIKey | XKCYMNCYAUYZDL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine?
The IUPAC name of 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine (CID 175487726) is 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine.
What is the SMILES notation for 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine?
The canonical SMILES for 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine is c1cnn(-c2ccc(-c3nccc(CCC4OCCCO4)n3)cc2)c1.
What is the InChIKey of 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine?
The InChIKey is XKCYMNCYAUYZDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c1-10-21-23(12-1)17-6-3-15(4-7-17)19-20-11-9-16(22-19)5-8-18-24-13-2-14-25-18/h1,3-4,6-7,9-12,18H,2,5,8,13-14H2.
What are the key properties of 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine?
4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine has a molecular weight of 336.39 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxan-2-yl)ethyl]-2-(4-pyrazol-1-ylphenyl)pyrimidine is sourced from PubChem (CID 175487726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).