C14H18O4S — CID 175488312
3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl 4-methylbenzenesulfonate (PubChem CID 175488312) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl 4-methylbenzenesulfonate.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175488312 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-6-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC3CCOC32)cc1 |
| InChI | InChI=1S/C14H18O4S/c1-10-2-5-12(6-3-10)19(15,16)18-13-7-4-11-8-9-17-14(11)13/h2-3,5-6,11,13-14H,4,7-9H2,1H3 |
| InChIKey | NSEJGYBISZSMHI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|