C13H18N2O — CID 175488759
3-[(2S)-butan-2-yl]-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one (PubChem CID 175488759) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-[(2S)-butan-2-yl]-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 175488759 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one |
| SMILES | CC[C@H](C)C1NCc2ccccc2NC1=O |
| InChI | InChI=1S/C13H18N2O/c1-3-9(2)12-13(16)15-11-7-5-4-6-10(11)8-14-12/h4-7,9,12,14H,3,8H2,1-2H3,(H,15,16)/t9-,12?/m0/s1 |
| InChIKey | BEBJKZAFXLTRHP-QHGLUPRGSA-N |
| XLogP | 2.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |