C15H28N2O2Si — CID 175489258
2-[[4-(methoxymethyl)-4,5,6,7-tetrahydroindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 175489258) has the molecular formula C15H28N2O2Si and a molecular weight of 296.49 g/mol. Its IUPAC name is 2-[[4-(methoxymethyl)-4,5,6,7-tetrahydroindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(methoxymethyl)-4,5,6,7-tetrahydroindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175489258 |
| Molecular Formula | C15H28N2O2Si |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-[[4-(methoxymethyl)-4,5,6,7-tetrahydroindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COCC1CCCc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H28N2O2Si/c1-18-11-13-6-5-7-15-14(13)10-16-17(15)12-19-8-9-20(2,3)4/h10,13H,5-9,11-12H2,1-4H3 |
| InChIKey | VSNYXEKOKKONQL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|