C15H30N4O4SSi — CID 175489303
[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methoxymethanesulfonohydrazide (PubChem CID 175489303) has the molecular formula C15H30N4O4SSi and a molecular weight of 390.58 g/mol. Its IUPAC name is [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methoxymethanesulfonohydrazide.
| Compound Name | [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methoxymethanesulfonohydrazide |
|---|---|
| PubChem CID | 175489303 |
| Molecular Formula | C15H30N4O4SSi |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methoxymethanesulfonohydrazide |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1CCCC2COCS(=O)(=O)NN |
| InChI | InChI=1S/C15H30N4O4SSi/c1-25(2,3)8-7-22-11-19-15-6-4-5-13(14(15)9-17-19)10-23-12-24(20,21)18-16/h9,13,18H,4-8,10-12,16H2,1-3H3 |
| InChIKey | OVEJKUKDWMROAF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|