About 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate
1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate (PubChem CID 175489856) has the molecular formula C9H10Cl3N3O3
and a molecular weight of 314.56 g/mol. Its IUPAC name is 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate.
Molecular Properties
| Compound Name | 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate |
| PubChem CID | 175489856 |
| Molecular Formula | C9H10Cl3N3O3 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate |
| SMILES | CCC(COc1c(Cl)nc(Cl)nc1Cl)OC(N)=O |
| InChI | InChI=1S/C9H10Cl3N3O3/c1-2-4(18-9(13)16)3-17-5-6(10)14-8(12)15-7(5)11/h4H,2-3H2,1H3,(H2,13,16) |
| InChIKey | MMSJNQOJPHQQDF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate?
The IUPAC name of 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate (CID 175489856) is 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate.
What is the SMILES notation for 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate?
The canonical SMILES for 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate is CCC(COc1c(Cl)nc(Cl)nc1Cl)OC(N)=O.
What is the InChIKey of 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate?
The InChIKey is MMSJNQOJPHQQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl3N3O3/c1-2-4(18-9(13)16)3-17-5-6(10)14-8(12)15-7(5)11/h4H,2-3H2,1H3,(H2,13,16).
What are the key properties of 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate?
1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate has a molecular weight of 314.56 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,6-trichloropyrimidin-5-yl)oxybutan-2-yl carbamate is sourced from PubChem (CID 175489856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).