C9H10F6N2O — CID 175490050
6-(1,2,2,3,3,3-hexafluoropropoxy)cyclohexa-2,4-diene-1,1-diamine (PubChem CID 175490050) has the molecular formula C9H10F6N2O and a molecular weight of 276.18 g/mol. Its IUPAC name is 6-(1,2,2,3,3,3-hexafluoropropoxy)cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 6-(1,2,2,3,3,3-hexafluoropropoxy)cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 175490050 |
| Molecular Formula | C9H10F6N2O |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-(1,2,2,3,3,3-hexafluoropropoxy)cyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC=CC1OC(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F6N2O/c10-6(8(11,12)9(13,14)15)18-5-3-1-2-4-7(5,16)17/h1-6H,16-17H2 |
| InChIKey | AHZSFUZUEMUNDY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|