About 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde
8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde (PubChem CID 175490486) has the molecular formula C10H8FNO2
and a molecular weight of 193.18 g/mol. Its IUPAC name is 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde.
Molecular Properties
| Compound Name | 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
| PubChem CID | 175490486 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde |
| SMILES | CC1=Nc2c(F)cccc2C(C=O)O1 |
| InChI | InChI=1S/C10H8FNO2/c1-6-12-10-7(9(5-13)14-6)3-2-4-8(10)11/h2-5,9H,1H3 |
| InChIKey | SJHJXZJXLJSDSW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde?
The IUPAC name of 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde (CID 175490486) is 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde.
What is the SMILES notation for 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde?
The canonical SMILES for 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde is CC1=Nc2c(F)cccc2C(C=O)O1.
What is the InChIKey of 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde?
The InChIKey is SJHJXZJXLJSDSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FNO2/c1-6-12-10-7(9(5-13)14-6)3-2-4-8(10)11/h2-5,9H,1H3.
What are the key properties of 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde?
8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde has a molecular weight of 193.18 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-methyl-4H-3,1-benzoxazine-4-carbaldehyde is sourced from PubChem (CID 175490486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).