C10H15N3O5 — CID 175490837
formic acid;N-(2-methoxyethyl)-6-methyl-3-nitropyridin-2-amine (PubChem CID 175490837) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is formic acid;N-(2-methoxyethyl)-6-methyl-3-nitropyridin-2-amine.
| Compound Name | formic acid;N-(2-methoxyethyl)-6-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 175490837 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | formic acid;N-(2-methoxyethyl)-6-methyl-3-nitropyridin-2-amine |
| SMILES | COCCNc1nc(C)ccc1[N+](=O)[O-].O=CO |
| InChI | InChI=1S/C9H13N3O3.CH2O2/c1-7-3-4-8(12(13)14)9(11-7)10-5-6-15-2;2-1-3/h3-4H,5-6H2,1-2H3,(H,10,11);1H,(H,2,3) |
| InChIKey | ODRKOKBERRMVJV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|