C13H25NO3 — CID 175491842
1-hydroxy-N-(2-hydroxyethyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 175491842) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-hydroxy-N-(2-hydroxyethyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 1-hydroxy-N-(2-hydroxyethyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175491842 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-hydroxy-N-(2-hydroxyethyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(C)C)C(O)(C(=O)NCCO)C1 |
| InChI | InChI=1S/C13H25NO3/c1-9(2)11-5-4-10(3)8-13(11,17)12(16)14-6-7-15/h9-11,15,17H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | JYIKPJQTSNDTKW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |