About 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine
1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine (PubChem CID 175491909) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine |
| PubChem CID | 175491909 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine |
| SMILES | CCCCCc1cc2c(N)ccnc2n1C |
| InChI | InChI=1S/C13H19N3/c1-3-4-5-6-10-9-11-12(14)7-8-15-13(11)16(10)2/h7-9H,3-6H2,1-2H3,(H2,14,15) |
| InChIKey | CNPIULDBPBSRNF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine?
The IUPAC name of 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine (CID 175491909) is 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine.
What is the SMILES notation for 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine?
The canonical SMILES for 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine is CCCCCc1cc2c(N)ccnc2n1C.
What is the InChIKey of 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine?
The InChIKey is CNPIULDBPBSRNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-4-5-6-10-9-11-12(14)7-8-15-13(11)16(10)2/h7-9H,3-6H2,1-2H3,(H2,14,15).
What are the key properties of 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine?
1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine has a molecular weight of 217.32 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-pentylpyrrolo[2,3-b]pyridin-4-amine is sourced from PubChem (CID 175491909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).