About [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate
[3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate (PubChem CID 175491938) has the molecular formula C13H21N2O4P
and a molecular weight of 300.30 g/mol. Its IUPAC name is [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate |
| PubChem CID | 175491938 |
| Molecular Formula | C13H21N2O4P |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate |
| SMILES | CCN(C)CCC1CNc2cc(OP(=O)(O)O)ccc21 |
| InChI | InChI=1S/C13H21N2O4P/c1-3-15(2)7-6-10-9-14-13-8-11(4-5-12(10)13)19-20(16,17)18/h4-5,8,10,14H,3,6-7,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | MOAKQCWHAHOSHW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate?
The IUPAC name of [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate (CID 175491938) is [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate.
What is the SMILES notation for [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate?
The canonical SMILES for [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate is CCN(C)CCC1CNc2cc(OP(=O)(O)O)ccc21.
What is the InChIKey of [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate?
The InChIKey is MOAKQCWHAHOSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N2O4P/c1-3-15(2)7-6-10-9-14-13-8-11(4-5-12(10)13)19-20(16,17)18/h4-5,8,10,14H,3,6-7,9H2,1-2H3,(H2,16,17,18).
What are the key properties of [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate?
[3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate has a molecular weight of 300.30 g/mol, XLogP of 2.01, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-[ethyl(methyl)amino]ethyl]-2,3-dihydro-1H-indol-6-yl] dihydrogen phosphate is sourced from PubChem (CID 175491938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).