About methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate
methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate (PubChem CID 175491965) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 175491965 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)C1(O)COCN1 |
| InChI | InChI=1S/C5H9NO4/c1-9-4(7)5(8)2-10-3-6-5/h6,8H,2-3H2,1H3 |
| InChIKey | IUKMEYLUBAOQCQ-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate?
The IUPAC name of methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate (CID 175491965) is methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate is COC(=O)C1(O)COCN1.
What is the InChIKey of methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate?
The InChIKey is IUKMEYLUBAOQCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c1-9-4(7)5(8)2-10-3-6-5/h6,8H,2-3H2,1H3.
What are the key properties of methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate?
methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate has a molecular weight of 147.13 g/mol, XLogP of -1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 175491965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).