C37H33N7O5 — CID 175493843
6,7-dimethoxy-2-[2-[4-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]phenyl]-1-(tetrazol-2-yl)ethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 175493843) has the molecular formula C37H33N7O5 and a molecular weight of 655.72 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-[4-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]phenyl]-1-(tetrazol-2-yl)ethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[2-[4-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]phenyl]-1-(tetrazol-2-yl)ethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 175493843 |
| Molecular Formula | C37H33N7O5 |
| Molecular Weight | 655.72 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 6,7-dimethoxy-2-[2-[4-[3-(2-nitro-5-pyridin-3-yloxyphenyl)phenyl]phenyl]-1-(tetrazol-2-yl)ethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(C(Cc1ccc(-c3cccc(-c4cc(Oc5cccnc5)ccc4[N+](=O)[O-])c3)cc1)n1ncnn1)CC2 |
| InChI | InChI=1S/C37H33N7O5/c1-47-35-19-28-14-16-42(23-30(28)20-36(35)48-2)37(43-40-24-39-41-43)17-25-8-10-26(11-9-25)27-5-3-6-29(18-27)33-21-31(12-13-34(33)44(45)46)49-32-7-4-15-38-22-32/h3-13,15,18-22,24,37H,14,16-17,23H2,1-2H3 |
| InChIKey | NDNJRPLTCUJJOZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 130.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|