About anthracene;thiophen-2-ylmethanamine
anthracene;thiophen-2-ylmethanamine (PubChem CID 175494003) has the molecular formula C19H17NS
and a molecular weight of 291.42 g/mol. Its IUPAC name is anthracene;thiophen-2-ylmethanamine.
Molecular Properties
| Compound Name | anthracene;thiophen-2-ylmethanamine |
| PubChem CID | 175494003 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | anthracene;thiophen-2-ylmethanamine |
| SMILES | NCc1cccs1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C5H7NS/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;6-4-5-2-1-3-7-5/h1-10H;1-3H,4,6H2 |
| InChIKey | FLZQBJUVRGALHI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;thiophen-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;thiophen-2-ylmethanamine?
The IUPAC name of anthracene;thiophen-2-ylmethanamine (CID 175494003) is anthracene;thiophen-2-ylmethanamine.
What is the SMILES notation for anthracene;thiophen-2-ylmethanamine?
The canonical SMILES for anthracene;thiophen-2-ylmethanamine is NCc1cccs1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;thiophen-2-ylmethanamine?
The InChIKey is FLZQBJUVRGALHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C5H7NS/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;6-4-5-2-1-3-7-5/h1-10H;1-3H,4,6H2.
What are the key properties of anthracene;thiophen-2-ylmethanamine?
anthracene;thiophen-2-ylmethanamine has a molecular weight of 291.42 g/mol, XLogP of 5.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;thiophen-2-ylmethanamine is sourced from PubChem (CID 175494003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).