C10H12N2O4S — CID 175494308
2-amino-4-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylic acid (PubChem CID 175494308) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-amino-4-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylic acid.
| Compound Name | 2-amino-4-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 175494308 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-amino-4-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylic acid |
| SMILES | CC1CN(C(=O)O)Cc2sc(N)c(C(=O)O)c21 |
| InChI | InChI=1S/C10H12N2O4S/c1-4-2-12(10(15)16)3-5-6(4)7(9(13)14)8(11)17-5/h4H,2-3,11H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | UZCYFHWWCNPPEM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|