About 2H-benzotriazole;3-phenylphthalic acid
2H-benzotriazole;3-phenylphthalic acid (PubChem CID 175494316) has the molecular formula C20H15N3O4
and a molecular weight of 361.36 g/mol. Its IUPAC name is 2H-benzotriazole;3-phenylphthalic acid.
Molecular Properties
| Compound Name | 2H-benzotriazole;3-phenylphthalic acid |
| PubChem CID | 175494316 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2H-benzotriazole;3-phenylphthalic acid |
| SMILES | O=C(O)c1cccc(-c2ccccc2)c1C(=O)O.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C14H10O4.C6H5N3/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;1-2-4-6-5(3-1)7-9-8-6/h1-8H,(H,15,16)(H,17,18);1-4H,(H,7,8,9) |
| InChIKey | RYLNZWMCVAAMFV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-benzotriazole;3-phenylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;3-phenylphthalic acid?
The IUPAC name of 2H-benzotriazole;3-phenylphthalic acid (CID 175494316) is 2H-benzotriazole;3-phenylphthalic acid.
What is the SMILES notation for 2H-benzotriazole;3-phenylphthalic acid?
The canonical SMILES for 2H-benzotriazole;3-phenylphthalic acid is O=C(O)c1cccc(-c2ccccc2)c1C(=O)O.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;3-phenylphthalic acid?
The InChIKey is RYLNZWMCVAAMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.C6H5N3/c15-13(16)11-8-4-7-10(12(11)14(17)18)9-5-2-1-3-6-9;1-2-4-6-5(3-1)7-9-8-6/h1-8H,(H,15,16)(H,17,18);1-4H,(H,7,8,9).
What are the key properties of 2H-benzotriazole;3-phenylphthalic acid?
2H-benzotriazole;3-phenylphthalic acid has a molecular weight of 361.36 g/mol, XLogP of 3.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;3-phenylphthalic acid is sourced from PubChem (CID 175494316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).