About 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid
5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (PubChem CID 175494363) has the molecular formula C11H10F3NO3
and a molecular weight of 261.20 g/mol. Its IUPAC name is 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| PubChem CID | 175494363 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OC(F)C(F)F)c(C2CC2)cn1 |
| InChI | InChI=1S/C11H10F3NO3/c12-9(13)10(14)18-8-3-7(11(16)17)15-4-6(8)5-1-2-5/h3-5,9-10H,1-2H2,(H,16,17) |
| InChIKey | XTSOYJYFRRMNFG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The IUPAC name of 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CID 175494363) is 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid is O=C(O)c1cc(OC(F)C(F)F)c(C2CC2)cn1.
What is the InChIKey of 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
The InChIKey is XTSOYJYFRRMNFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO3/c12-9(13)10(14)18-8-3-7(11(16)17)15-4-6(8)5-1-2-5/h3-5,9-10H,1-2H2,(H,16,17).
What are the key properties of 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid?
5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid has a molecular weight of 261.20 g/mol, XLogP of 2.60, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-4-(1,2,2-trifluoroethoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 175494363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).