C18H26Cl2O3 — CID 175494569
(4-chloro-2,6-dimethylheptyl) 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 175494569) has the molecular formula C18H26Cl2O3 and a molecular weight of 361.31 g/mol. Its IUPAC name is (4-chloro-2,6-dimethylheptyl) 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | (4-chloro-2,6-dimethylheptyl) 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 175494569 |
| Molecular Formula | C18H26Cl2O3 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (4-chloro-2,6-dimethylheptyl) 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)OCC(C)CC(Cl)CC(C)C |
| InChI | InChI=1S/C18H26Cl2O3/c1-12(2)7-16(20)8-13(3)10-23-18(21)11-22-17-6-5-15(19)9-14(17)4/h5-6,9,12-13,16H,7-8,10-11H2,1-4H3 |
| InChIKey | NTKORMXQQBNYCT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|