About methanimidamide;2-(trifluoromethyl)pyridine
methanimidamide;2-(trifluoromethyl)pyridine (PubChem CID 175495104) has the molecular formula C7H8F3N3
and a molecular weight of 191.16 g/mol. Its IUPAC name is methanimidamide;2-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | methanimidamide;2-(trifluoromethyl)pyridine |
| PubChem CID | 175495104 |
| Molecular Formula | C7H8F3N3 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methanimidamide;2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccccn1.[H]/N=C/N |
| InChI | InChI=1S/C6H4F3N.CH4N2/c7-6(8,9)5-3-1-2-4-10-5;2-1-3/h1-4H;1H,(H3,2,3) |
| InChIKey | PCMHBDGYTOEWFU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanimidamide;2-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimidamide;2-(trifluoromethyl)pyridine?
The IUPAC name of methanimidamide;2-(trifluoromethyl)pyridine (CID 175495104) is methanimidamide;2-(trifluoromethyl)pyridine.
What is the SMILES notation for methanimidamide;2-(trifluoromethyl)pyridine?
The canonical SMILES for methanimidamide;2-(trifluoromethyl)pyridine is FC(F)(F)c1ccccn1.[H]/N=C/N.
What is the InChIKey of methanimidamide;2-(trifluoromethyl)pyridine?
The InChIKey is PCMHBDGYTOEWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N.CH4N2/c7-6(8,9)5-3-1-2-4-10-5;2-1-3/h1-4H;1H,(H3,2,3).
What are the key properties of methanimidamide;2-(trifluoromethyl)pyridine?
methanimidamide;2-(trifluoromethyl)pyridine has a molecular weight of 191.16 g/mol, XLogP of 1.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanimidamide;2-(trifluoromethyl)pyridine is sourced from PubChem (CID 175495104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).