C16H26O2 — CID 175495239
propyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-methylprop-2-enoate (PubChem CID 175495239) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is propyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-methylprop-2-enoate.
| Compound Name | propyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175495239 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | propyl 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-2-methylprop-2-enoate |
| SMILES | CCCOC(=O)C(C)=CC1CCC2CCCCC12 |
| InChI | InChI=1S/C16H26O2/c1-3-10-18-16(17)12(2)11-14-9-8-13-6-4-5-7-15(13)14/h11,13-15H,3-10H2,1-2H3 |
| InChIKey | JLEGTXDBCZVFRI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|