C27H34O4 — CID 175495515
methyl 2-benzylidenepentanoate;methyl 2-methyl-3-phenylhex-2-enoate (PubChem CID 175495515) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-benzylidenepentanoate;methyl 2-methyl-3-phenylhex-2-enoate.
| Compound Name | methyl 2-benzylidenepentanoate;methyl 2-methyl-3-phenylhex-2-enoate |
|---|---|
| PubChem CID | 175495515 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl 2-benzylidenepentanoate;methyl 2-methyl-3-phenylhex-2-enoate |
| SMILES | CCCC(=C(C)C(=O)OC)c1ccccc1.CCCC(=Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C14H18O2.C13H16O2/c1-4-8-13(11(2)14(15)16-3)12-9-6-5-7-10-12;1-3-7-12(13(14)15-2)10-11-8-5-4-6-9-11/h5-7,9-10H,4,8H2,1-3H3;4-6,8-10H,3,7H2,1-2H3 |
| InChIKey | QJTLXFDNKJVHMQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|