About 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione
3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione (PubChem CID 175495917) has the molecular formula C15H13N3O3
and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione |
| PubChem CID | 175495917 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2ccc3ncoc3c2)c(NC2CCC2)c1=O |
| InChI | InChI=1S/C15H13N3O3/c19-14-12(17-8-2-1-3-8)13(15(14)20)18-9-4-5-10-11(6-9)21-7-16-10/h4-8,17-18H,1-3H2 |
| InChIKey | KISLCJUDOPTRHY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione (CID 175495917) is 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione is O=c1c(Nc2ccc3ncoc3c2)c(NC2CCC2)c1=O.
What is the InChIKey of 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione?
The InChIKey is KISLCJUDOPTRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O3/c19-14-12(17-8-2-1-3-8)13(15(14)20)18-9-4-5-10-11(6-9)21-7-16-10/h4-8,17-18H,1-3H2.
What are the key properties of 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione?
3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione has a molecular weight of 283.29 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzoxazol-6-ylamino)-4-(cyclobutylamino)cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 175495917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).