About dec-2-ene-1-sulfinic acid
dec-2-ene-1-sulfinic acid (PubChem CID 175496149) has the molecular formula C10H20O2S
and a molecular weight of 204.33 g/mol. Its IUPAC name is dec-2-ene-1-sulfinic acid.
Molecular Properties
| Compound Name | dec-2-ene-1-sulfinic acid |
| PubChem CID | 175496149 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | dec-2-ene-1-sulfinic acid |
| SMILES | CCCCCCCC=CCS(=O)O |
| InChI | InChI=1S/C10H20O2S/c1-2-3-4-5-6-7-8-9-10-13(11)12/h8-9H,2-7,10H2,1H3,(H,11,12) |
| InChIKey | DDZLSLLZTUJYDF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dec-2-ene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-2-ene-1-sulfinic acid?
The IUPAC name of dec-2-ene-1-sulfinic acid (CID 175496149) is dec-2-ene-1-sulfinic acid.
What is the SMILES notation for dec-2-ene-1-sulfinic acid?
The canonical SMILES for dec-2-ene-1-sulfinic acid is CCCCCCCC=CCS(=O)O.
What is the InChIKey of dec-2-ene-1-sulfinic acid?
The InChIKey is DDZLSLLZTUJYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S/c1-2-3-4-5-6-7-8-9-10-13(11)12/h8-9H,2-7,10H2,1H3,(H,11,12).
What are the key properties of dec-2-ene-1-sulfinic acid?
dec-2-ene-1-sulfinic acid has a molecular weight of 204.33 g/mol, XLogP of 3.12, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dec-2-ene-1-sulfinic acid is sourced from PubChem (CID 175496149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).