C12H18F5NO — CID 175496282
2-(5,5,6,6,6-pentafluorohexoxy)hexanenitrile (PubChem CID 175496282) has the molecular formula C12H18F5NO and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-(5,5,6,6,6-pentafluorohexoxy)hexanenitrile.
| Compound Name | 2-(5,5,6,6,6-pentafluorohexoxy)hexanenitrile |
|---|---|
| PubChem CID | 175496282 |
| Molecular Formula | C12H18F5NO |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(5,5,6,6,6-pentafluorohexoxy)hexanenitrile |
| SMILES | CCCCC(C#N)OCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F5NO/c1-2-3-6-10(9-18)19-8-5-4-7-11(13,14)12(15,16)17/h10H,2-8H2,1H3 |
| InChIKey | OUCXVFXFBVTTCX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|