C11H20N4 — CID 175496649
1,4-dimethyl-3,5,5a,6-tetrahydro-2H-1,4-benzodiazepine-8,9-diamine (PubChem CID 175496649) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1,4-dimethyl-3,5,5a,6-tetrahydro-2H-1,4-benzodiazepine-8,9-diamine.
| Compound Name | 1,4-dimethyl-3,5,5a,6-tetrahydro-2H-1,4-benzodiazepine-8,9-diamine |
|---|---|
| PubChem CID | 175496649 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1,4-dimethyl-3,5,5a,6-tetrahydro-2H-1,4-benzodiazepine-8,9-diamine |
| SMILES | CN1CCN(C)C2=C(N)C(N)=CCC2C1 |
| InChI | InChI=1S/C11H20N4/c1-14-5-6-15(2)11-8(7-14)3-4-9(12)10(11)13/h4,8H,3,5-7,12-13H2,1-2H3 |
| InChIKey | BSRKGCOWRJLGPD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |