About sodium;hydride;4-propoxybenzenethiol
sodium;hydride;4-propoxybenzenethiol (PubChem CID 175496916) has the molecular formula C9H13NaOS
and a molecular weight of 192.26 g/mol. Its IUPAC name is sodium;hydride;4-propoxybenzenethiol.
Molecular Properties
| Compound Name | sodium;hydride;4-propoxybenzenethiol |
| PubChem CID | 175496916 |
| Molecular Formula | C9H13NaOS |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | sodium;hydride;4-propoxybenzenethiol |
| SMILES | CCCOc1ccc(S)cc1.[H-].[Na+] |
| InChI | InChI=1S/C9H12OS.Na.H/c1-2-7-10-8-3-5-9(11)6-4-8;;/h3-6,11H,2,7H2,1H3;;/q;+1;-1 |
| InChIKey | YIPWWKSTCHIGTN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-propoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-propoxybenzenethiol?
The IUPAC name of sodium;hydride;4-propoxybenzenethiol (CID 175496916) is sodium;hydride;4-propoxybenzenethiol.
What is the SMILES notation for sodium;hydride;4-propoxybenzenethiol?
The canonical SMILES for sodium;hydride;4-propoxybenzenethiol is CCCOc1ccc(S)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-propoxybenzenethiol?
The InChIKey is YIPWWKSTCHIGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OS.Na.H/c1-2-7-10-8-3-5-9(11)6-4-8;;/h3-6,11H,2,7H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;4-propoxybenzenethiol?
sodium;hydride;4-propoxybenzenethiol has a molecular weight of 192.26 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-propoxybenzenethiol is sourced from PubChem (CID 175496916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).