About 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one
7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one (PubChem CID 175497179) has the molecular formula C15H16F3NO3
and a molecular weight of 315.29 g/mol. Its IUPAC name is 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one.
Molecular Properties
| Compound Name | 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one |
| PubChem CID | 175497179 |
| Molecular Formula | C15H16F3NO3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one |
| SMILES | CCN(CC)c1ccc2c(=O)cc(OC(F)C(F)F)oc2c1 |
| InChI | InChI=1S/C15H16F3NO3/c1-3-19(4-2)9-5-6-10-11(20)8-13(21-12(10)7-9)22-15(18)14(16)17/h5-8,14-15H,3-4H2,1-2H3 |
| InChIKey | UQLBQFWAOOOCMC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one?
The IUPAC name of 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one (CID 175497179) is 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one.
What is the SMILES notation for 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one?
The canonical SMILES for 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one is CCN(CC)c1ccc2c(=O)cc(OC(F)C(F)F)oc2c1.
What is the InChIKey of 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one?
The InChIKey is UQLBQFWAOOOCMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3NO3/c1-3-19(4-2)9-5-6-10-11(20)8-13(21-12(10)7-9)22-15(18)14(16)17/h5-8,14-15H,3-4H2,1-2H3.
What are the key properties of 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one?
7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one has a molecular weight of 315.29 g/mol, XLogP of 3.58, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethylamino)-2-(1,2,2-trifluoroethoxy)chromen-4-one is sourced from PubChem (CID 175497179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).