C34H28N10O6 — CID 175497568
N-(3-nitrophenyl)-1-[4-[5-[(3-nitrophenyl)carbamoyl]-3-pyridin-4-ylpyrazol-1-yl]butyl]-3-pyridin-4-ylpyrazole-5-carboxamide (PubChem CID 175497568) has the molecular formula C34H28N10O6 and a molecular weight of 672.66 g/mol. Its IUPAC name is N-(3-nitrophenyl)-1-[4-[5-[(3-nitrophenyl)carbamoyl]-3-pyridin-4-ylpyrazol-1-yl]butyl]-3-pyridin-4-ylpyrazole-5-carboxamide.
| Compound Name | N-(3-nitrophenyl)-1-[4-[5-[(3-nitrophenyl)carbamoyl]-3-pyridin-4-ylpyrazol-1-yl]butyl]-3-pyridin-4-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 175497568 |
| Molecular Formula | C34H28N10O6 |
| Molecular Weight | 672.66 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | N-(3-nitrophenyl)-1-[4-[5-[(3-nitrophenyl)carbamoyl]-3-pyridin-4-ylpyrazol-1-yl]butyl]-3-pyridin-4-ylpyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc(-c2ccncc2)nn1CCCCn1nc(-c2ccncc2)cc1C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H28N10O6/c45-33(37-25-5-3-7-27(19-25)43(47)48)31-21-29(23-9-13-35-14-10-23)39-41(31)17-1-2-18-42-32(22-30(40-42)24-11-15-36-16-12-24)34(46)38-26-6-4-8-28(20-26)44(49)50/h3-16,19-22H,1-2,17-18H2,(H,37,45)(H,38,46) |
| InChIKey | JCIDWPPERAYDAA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 205.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|