About 2-bromospiro[cyclopentane-1,1'-indene]
2-bromospiro[cyclopentane-1,1'-indene] (PubChem CID 175498392) has the molecular formula C13H13Br
and a molecular weight of 249.15 g/mol. Its IUPAC name is 2-bromospiro[cyclopentane-1,1'-indene].
Molecular Properties
| Compound Name | 2-bromospiro[cyclopentane-1,1'-indene] |
| PubChem CID | 175498392 |
| Molecular Formula | C13H13Br |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 2-bromospiro[cyclopentane-1,1'-indene] |
| SMILES | BrC1CCCC12C=Cc1ccccc12 |
| InChI | InChI=1S/C13H13Br/c14-12-6-3-8-13(12)9-7-10-4-1-2-5-11(10)13/h1-2,4-5,7,9,12H,3,6,8H2 |
| InChIKey | UOKOJEJLDORZLA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromospiro[cyclopentane-1,1'-indene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromospiro[cyclopentane-1,1'-indene]?
The IUPAC name of 2-bromospiro[cyclopentane-1,1'-indene] (CID 175498392) is 2-bromospiro[cyclopentane-1,1'-indene].
What is the SMILES notation for 2-bromospiro[cyclopentane-1,1'-indene]?
The canonical SMILES for 2-bromospiro[cyclopentane-1,1'-indene] is BrC1CCCC12C=Cc1ccccc12.
What is the InChIKey of 2-bromospiro[cyclopentane-1,1'-indene]?
The InChIKey is UOKOJEJLDORZLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Br/c14-12-6-3-8-13(12)9-7-10-4-1-2-5-11(10)13/h1-2,4-5,7,9,12H,3,6,8H2.
What are the key properties of 2-bromospiro[cyclopentane-1,1'-indene]?
2-bromospiro[cyclopentane-1,1'-indene] has a molecular weight of 249.15 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromospiro[cyclopentane-1,1'-indene] is sourced from PubChem (CID 175498392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).