C12H18O5 — CID 175499434
but-3-en-1-ol;3-prop-2-enoxycarbonylbut-3-enoic acid (PubChem CID 175499434) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is but-3-en-1-ol;3-prop-2-enoxycarbonylbut-3-enoic acid.
| Compound Name | but-3-en-1-ol;3-prop-2-enoxycarbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 175499434 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | but-3-en-1-ol;3-prop-2-enoxycarbonylbut-3-enoic acid |
| SMILES | C=CCCO.C=CCOC(=O)C(=C)CC(=O)O |
| InChI | InChI=1S/C8H10O4.C4H8O/c1-3-4-12-8(11)6(2)5-7(9)10;1-2-3-4-5/h3H,1-2,4-5H2,(H,9,10);2,5H,1,3-4H2 |
| InChIKey | WBQMJTUOZVLKQS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|