About bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate
bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate (PubChem CID 175499690) has the molecular formula C30H18O10
and a molecular weight of 538.46 g/mol. Its IUPAC name is bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate.
Molecular Properties
| Compound Name | bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate |
| PubChem CID | 175499690 |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate |
| SMILES | O=C(Oc1cccc2oc3ccccc3c(=O)c12)C(O)C(O)C(=O)Oc1cccc2oc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C30H18O10/c31-25-15-7-1-3-9-17(15)37-19-11-5-13-21(23(19)25)39-29(35)27(33)28(34)30(36)40-22-14-6-12-20-24(22)26(32)16-8-2-4-10-18(16)38-20/h1-14,27-28,33-34H |
| InChIKey | KNECCXVOSHOAQV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate?
The IUPAC name of bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate (CID 175499690) is bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate.
What is the SMILES notation for bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate?
The canonical SMILES for bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate is O=C(Oc1cccc2oc3ccccc3c(=O)c12)C(O)C(O)C(=O)Oc1cccc2oc3ccccc3c(=O)c12.
What is the InChIKey of bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate?
The InChIKey is KNECCXVOSHOAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18O10/c31-25-15-7-1-3-9-17(15)37-19-11-5-13-21(23(19)25)39-29(35)27(33)28(34)30(36)40-22-14-6-12-20-24(22)26(32)16-8-2-4-10-18(16)38-20/h1-14,27-28,33-34H.
What are the key properties of bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate?
bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate has a molecular weight of 538.46 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9-oxoxanthen-1-yl) 2,3-dihydroxybutanedioate is sourced from PubChem (CID 175499690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).