C24H27Cl2FN4O2 — CID 175500214
N-[1-(2-fluoro-3-methyl-5-nitrophenyl)ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)quinolin-4-amine;dihydrochloride (PubChem CID 175500214) has the molecular formula C24H27Cl2FN4O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is N-[1-(2-fluoro-3-methyl-5-nitrophenyl)ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)quinolin-4-amine;dihydrochloride.
| Compound Name | N-[1-(2-fluoro-3-methyl-5-nitrophenyl)ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)quinolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 175500214 |
| Molecular Formula | C24H27Cl2FN4O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-[1-(2-fluoro-3-methyl-5-nitrophenyl)ethyl]-2-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)quinolin-4-amine;dihydrochloride |
| SMILES | Cc1cc(NC(C)c2cc([N+](=O)[O-])cc(C)c2F)c2cc(C3=CCNCC3)ccc2n1.Cl.Cl |
| InChI | InChI=1S/C24H25FN4O2.2ClH/c1-14-10-19(29(30)31)13-20(24(14)25)16(3)28-23-11-15(2)27-22-5-4-18(12-21(22)23)17-6-8-26-9-7-17;;/h4-6,10-13,16,26H,7-9H2,1-3H3,(H,27,28);2*1H |
| InChIKey | IQZDEDOHJFOIFA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|